diphenyl sulfide


benzene sulfide; diphenyl sulfide; diphenyl sulphide; phenylsulfanylbenzene; phenyl sulfide; phenyl sulphide; phenylthiobenzene; 1,1'-sulfanediyldibenzene
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Diphenylsulfid); p. 364,
📖Houben-Weyl, 2. Band (Phenylsulfid); p. 166
CAS:[139-66-2]
Formula:C12H10S; 186.28 g/mol
InChiKey:LTYMSROWYAPPGB-UHFFFAOYSA-N
SMILES:S(c1ccccc1)c2ccccc2
Molecular structure of diphenyl sulfide
Density:1.114 g/mL
Molar volume:167.3 mL/mol
Refractive index:1.633
Molecular refractive power:59.77 mL/mol
Dipole moment:1.55 D
Melting point:-40 °C
Boiling point:293 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Surface tension:42.54 dyn/cm
Log10 partition octanol / water:4.45

Isomers

biphenyl-4-thiol
Molecular structure of biphenyl-4-thiol
diphenyl sulfide
Molecular structure of diphenyl sulfide