diphenyl oxalate

Home   ::   Tables for Chemistry   ::   Compound classes

diphenyl etandioate; diphenyl oxalate; oxalic acid diphenyl ester
Links:🌍 Wikipedia
CAS RN:[3155-16-6]
Formula:C14H10O4; 242.23 g/mol
InChiKey:ULOZDEVJRTYKFE-UHFFFAOYSA-N
SMILES:O=C(Oc1ccccc1)C(=O)Oc2ccccc2
Molecular structure of diphenyl oxalate
Dipole moment:2.30 D

Isomers

4-(benzoyloxy)benzoic acid
Molecular structure of 4-(benzoyloxy)benzoic acid
benzoyl peroxide
Molecular structure of benzoyl peroxide
biphenyl-2,2'-dicarboxylic acid
Molecular structure of biphenyl-2,2'-dicarboxylic acid
biphenyl-4,4'-dicarboxylic acid
Molecular structure of biphenyl-4,4'-dicarboxylic acid
1,2-bis(2-hydroxyphenyl)ethane-1,2-dione
Molecular structure of 1,2-bis(2-hydroxyphenyl)ethane-1,2-dione
dimethyl 3,3'-benzene-1,3-diylbisprop-2-ynoate
Molecular structure of dimethyl 3,3'-benzene-1,3-diylbisprop-2-ynoate
diphenyl oxalate
Molecular structure of diphenyl oxalate
2-(2-hydroxybenzoyl)benzoic acid
Molecular structure of 2-(2-hydroxybenzoyl)benzoic acid
2-(4-hydroxybenzoyl)benzoic acid
Molecular structure of 2-(4-hydroxybenzoyl)benzoic acid
  ::