diphenyl ether


diphenyl ether; diphenyloxide; 1,1'-oxybisbenzene; phenoxybenzene; phenyl ether
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Diphenyl├Ąther); p. 87, 452, 455, 598, 905
CAS:[101-84-8]
Formula:C12H10O; 170.21 g/mol
InChiKey:USIUVYZYUHIAEV-UHFFFAOYSA-N
SMILES:O(c1ccccc1)c2ccccc2
Molecular structure of diphenyl ether
Density:1.070 g/mL
Molar volume:159.1 mL/mol
Refractive index:1.579
Molecular refractive power:52.87 mL/mol
Dielectric constant:3.90
Dipole moment:1.17 D
Melting point:28 °C
Boiling point:257 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Solubility in water:0 % w/w
Log10 partition octanol / water:4.21
Dimroth ET:35.5
Hildebrant solubility parameter (δ):9.8

Isomers

1-acetylazulene
Molecular structure of 1-acetylazulene
1-acetylnaphthalene
Molecular structure of 1-acetylnaphthalene
2-acetylnaphthalene
Molecular structure of 2-acetylnaphthalene
1,2-dihydroacenaphthylen-1-ol
Molecular structure of 1,2-dihydroacenaphthylen-1-ol
diphenyl ether
Molecular structure of diphenyl ether
1-formyl-2-methylnaphthalene
Molecular structure of 1-formyl-2-methylnaphthalene
8-methylbenzo[7]annulen-7-one
Molecular structure of 8-methylbenzo[7]annulen-7-one
4-methyl-1-naphthaldehyde
Molecular structure of 4-methyl-1-naphthaldehyde
2-phenylphenol
Molecular structure of 2-phenylphenol
3-phenylphenol
Molecular structure of 3-phenylphenol
4-phenylphenol
Molecular structure of 4-phenylphenol