diphenyl disulfide


diphenyl disulfide; diphenyl disulphide; phenyldisulfanylbenzene; phenyl disulfide
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Diphenyldisulfid); p. 365
CAS:[882-33-7]
Formula:C12H10S2; 218.34 g/mol
InChiKey:GUUVPOWQJOLRAS-UHFFFAOYSA-N
SMILES:S(Sc1ccccc1)c2ccccc2
Molecular structure of diphenyl disulfide
Dipole moment:1.90 D
Melting point:60 °C
Boiling point:310 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:4.41

Isomers

biphenyl-4,4'-dithiol
Molecular structure of biphenyl-4,4'-dithiol
diphenyl disulfide
Molecular structure of diphenyl disulfide