dipentyl hexanedioate


amyl adipate; n-amyl adipate; di-n-amyl adipate; diamyl adipate; dipentyl hexanedioate
CAS:[14027-78-2]
Formula:C16H30O4; 286.41 g/mol
InChiKey:UPPJFVSCGFPFHM-UHFFFAOYSA-N
SMILES:CCCCCOC(=O)CCCCC(=O)OCCCCC
Molecular structure of dipentyl hexanedioate
Density:0.948 g/mL
Molar volume:302.1 mL/mol
Refractive index:1.439
Molecular refractive power:79.47 mL/mol
Dipole moment:2.51 D
Surface tension:31.63 dyn/cm

Isomers

2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-yne
Molecular structure of 2,5-bis(tert-butylperoxy)-2,5-dimethylhex-3-yne
bis(3-methylbutyl) hexanedioate
Molecular structure of bis(3-methylbutyl) hexanedioate
dibutyl octanedioate
Molecular structure of dibutyl octanedioate
dibutyl 2-pentylpropanedioate
Molecular structure of dibutyl 2-pentylpropanedioate
diheptyl oxalate
Molecular structure of diheptyl oxalate
diisopropyl sebacate
Molecular structure of diisopropyl sebacate
dipentyl hexanedioate
Molecular structure of dipentyl hexanedioate
dipropyl decanedioate
Molecular structure of dipropyl decanedioate
hexadecanedioic acid
Molecular structure of hexadecanedioic acid
6-(1-hydroxy-1-propylbutyl)-2,2,6-trimethyltetrahydro-2H-pyran-3-carboxylic acid
Molecular structure of 6-(1-hydroxy-1-propylbutyl)-2,2,6-trimethyltetrahydro-2H-pyran-3-carboxylic acid
2,2,4-trimethyl-1,3-pentanediol diisobutyrate
Molecular structure of 2,2,4-trimethyl-1,3-pentanediol diisobutyrate