dioctyl benzene-1,4-dicarboxylate


dioctyl benzene-1,4-dicarboxylate; dioctyl terephthalate
Links:📏 NIST, 🕷 ChemSpider
CAS:[4654-26-6]
Formula:C24H38O4; 390.56 g/mol
InChiKey:OEIWPNWSDYFMIL-UHFFFAOYSA-N
SMILES:CCCCCCCCOC(=O)c1ccc(cc1)C(=O)OCCCCCCCC
Molecular structure of dioctyl benzene-1,4-dicarboxylate
Density:0.984 g/mL
Molar volume:396.9 mL/mol
Dipole moment:2.54 D
Melting point:43 °C
Boiling point:400 °C

Isomers

apocholic acid
Molecular structure of apocholic acid
bis(2-ethylhexyl) phthalate
Molecular structure of bis(2-ethylhexyl) phthalate
bis(6-methylheptyl) benzene-1,2-dicarboxylate
Molecular structure of bis(6-methylheptyl) benzene-1,2-dicarboxylate
bis(6-methylheptyl) benzene-1,4-dicarboxylate
Molecular structure of bis(6-methylheptyl) benzene-1,4-dicarboxylate
2,5-bis(octyloxy)terephthalaldehyde
Molecular structure of 2,5-bis(octyloxy)terephthalaldehyde
decyl hexyl 1,2-benzenedicarboxylate
Molecular structure of decyl hexyl 1,2-benzenedicarboxylate
3,12-dihydroxychol-8(14)-en-24-oic acid
Molecular structure of 3,12-dihydroxychol-8(14)-en-24-oic acid
dioctyl benzene-1,2-dicarboxylate
Molecular structure of dioctyl benzene-1,2-dicarboxylate
dioctyl benzene-1,4-dicarboxylate
Molecular structure of dioctyl benzene-1,4-dicarboxylate
12-hydroxy-3-oxocholan-24-oic acid
Molecular structure of 12-hydroxy-3-oxocholan-24-oic acid
7-ketolithocholic acid
Molecular structure of 7-ketolithocholic acid