dinonyl hexanedioate


dinonyl adipate; dinonyl hexanedioate
CAS:[151-32-6]
Formula:C24H46O4; 398.63 g/mol
InChiKey:WIYAGHSNPUBKDT-UHFFFAOYSA-N
SMILES:CCCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCCC
Molecular structure of dinonyl hexanedioate
Density:0.936 g/mL
Molar volume:425.9 mL/mol
Refractive index:1.449
Molecular refractive power:114.21 mL/mol
Dipole moment:2.53 D

Isomers

1,6-bis(7-methyloctyl) hexanedioate
Molecular structure of 1,6-bis(7-methyloctyl) hexanedioate
decyl octyl hexanedioate
Molecular structure of decyl octyl hexanedioate
dilauroyl peroxide
Molecular structure of dilauroyl peroxide
dinonyl hexanedioate
Molecular structure of dinonyl hexanedioate