dinonyl decanedioate


dinonyl decanedioate; dinonyl sebacate
Links:📏 NIST
CAS:[4121-16-8]
Formula:C28H54O4; 454.73 g/mol
InChiKey:VNTXONBESJNLBI-UHFFFAOYSA-N
SMILES:CCCCCCCCCOC(=O)CCCCCCCCC(=O)OCCCCCCCCC
Molecular structure of dinonyl decanedioate
Dipole moment:2.62 D