dinonyl (Z)-but-2-enedioate


dinonyl (Z)-but-2-enedioate; dinonyl maleate
Links:📏 NIST, 🕷 ChemSpider
CAS:[2787-64-6]
Formula:C22H40O4; 368.56 g/mol
InChiKey:PQJYOOFQDXGDDS-ZCXUNETKSA-N
SMILES:CCCCCCCCCOC(=O)C=C/C(=O)OCCCCCCCCC
Molecular structure of dinonyl (Z)-but-2-enedioate
Density:0.931 g/mL
Molar volume:395.9 mL/mol
Refractive index:1.456
Molecular refractive power:107.54 mL/mol
Dipole moment:2.66 D