dimethyldiphenoxysilane


dimethyldiphenoxysilane
CAS:[3440-02-6]
Formula:C14H16O2Si; 244.37 g/mol
InChiKey:SWLVAJXQIOKFSJ-UHFFFAOYSA-N
SMILES:C[Si](C)(Oc1ccccc1)Oc2ccccc2
Molecular structure of dimethyldiphenoxysilane
Dielectric constant:3.56
Dipole moment:1.21 D
Melting point:-23 °C

Isomers

dimethoxydiphenylsilane
Molecular structure of dimethoxydiphenylsilane
dimethyldiphenoxysilane
Molecular structure of dimethyldiphenoxysilane