diisopropyldimethylsilane


diisopropyldimethylsilane; dimethyldiisopropylsilane; dimethyl-di(propan-2-yl)silane
CAS:[3429-53-6]
Formula:C8H20Si; 144.33 g/mol
InChiKey:QFMAXCHTUPRFOZ-UHFFFAOYSA-N
SMILES:CC(C)[Si](C)(C)C(C)C
Molecular structure of diisopropyldimethylsilane
Dipole moment:1.39 D

Isomers

di-tert-butylsilane
Molecular structure of di-tert-butylsilane
diisopropyldimethylsilane
Molecular structure of diisopropyldimethylsilane
tetraethylsilane
Molecular structure of tetraethylsilane
trimethyl-pentylsilane
Molecular structure of trimethyl-pentylsilane