diisopropyl phosphite


diisopropyl phosphite
Links:📏 NIST, 📖 PubMed
CAS:[1809-20-7]
Formula:C6H14O3P; 165.15 g/mol
InChiKey:IWEDBEZKWHRUJX-UHFFFAOYSA-N
SMILES:CC(C)OP([O-])OC(C)C
Molecular structure of diisopropyl phosphite
Density:0.990 g/mL
Molar volume:166.8 mL/mol
Refractive index:1.408
Molecular refractive power:41.11 mL/mol
Dipole moment:3.08 D
Log10 partition octanol / water:0.45

Isomers

diisopropyl phosphite
Molecular structure of diisopropyl phosphite
dipropyl phosphite
Molecular structure of dipropyl phosphite