diisobutyl sulfoxide


diisobutyl sulfoxide; diisobutyl sulphoxide
CAS:[3085-40-3]
Formula:C8H18OS; 162.30 g/mol
InChiKey:MCDJZKPTBCWNSJ-UHFFFAOYSA-N
SMILES:CC(C)C[S](=O)CC(C)C
Molecular structure of diisobutyl sulfoxide
Dipole moment:3.90 D

Isomers

n-butyl sec-butyl sulfoxide
Molecular structure of n-butyl sec-butyl sulfoxide
n-butyl tert-butyl sulfoxide
Molecular structure of n-butyl tert-butyl sulfoxide
sec-butyl tert-butyl sulfoxide
Molecular structure of sec-butyl tert-butyl sulfoxide
tert-butyl isobutyl sulfoxide
Molecular structure of tert-butyl isobutyl sulfoxide
dibutyl sulfoxide
Molecular structure of dibutyl sulfoxide
diisobutyl sulfoxide
Molecular structure of diisobutyl sulfoxide
8-mercapto-1-octanol
Molecular structure of 8-mercapto-1-octanol