dihexyl benzene-1,4-dicarboxylate


dihexyl benzene-1,4-dicarboxylate; dihexyl terephthalate
Links:📏 NIST
CAS:[1818-96-8]
Formula:C20H30O4; 334.46 g/mol
InChiKey:MLIPQTRXLNTCRS-UHFFFAOYSA-N
SMILES:CCCCCCOC(=O)c1ccc(cc1)C(=O)OCCCCCC
Molecular structure of dihexyl benzene-1,4-dicarboxylate
Dipole moment:2.52 D
Melting point:37 °C

Isomers

butyl 2-ethylhexyl phthalate
Molecular structure of butyl 2-ethylhexyl phthalate
9-deoxy-9,10-didehydro-12,13-didehydro-13,14-dihydroprostaglandin Δ2
Molecular structure of 9-deoxy-9,10-didehydro-12,13-didehydro-13,14-dihydroprostaglandin D2
9-deoxy-δ-9-prostaglandin Δ2
Molecular structure of 9-deoxy-d-9-prostaglandin D2
dihexyl benzene-1,2-dicarboxylate
Molecular structure of dihexyl benzene-1,2-dicarboxylate
dihexyl benzene-1,3-dicarboxylate
Molecular structure of dihexyl benzene-1,3-dicarboxylate
dihexyl benzene-1,4-dicarboxylate
Molecular structure of dihexyl benzene-1,4-dicarboxylate