difluoromethylsulfonylbenzene


difluoromethyl phenyl sulfone; difluoromethylsulfonylbenzene; phenyl difluoromethyl sulfone
Links:🕷 ChemSpider
CAS:[1535-65-5]
Formula:C7H6F2O2S; 192.19 g/mol
InChiKey:LRHDNAVPELLXDL-UHFFFAOYSA-N
SMILES:FC(F)[S](=O)(=O)c1ccccc1
Molecular structure of difluoromethylsulfonylbenzene
Density:1.324 g/mL
Molar volume:145.2 mL/mol
Refractive index:1.500
Molecular refractive power:42.69 mL/mol
Dipole moment:4.08 D

Isomers

difluoromethylsulfonylbenzene
Molecular structure of difluoromethylsulfonylbenzene
4-fluoro-2-methylbenzenesulfonyl fluoride
Molecular structure of 4-fluoro-2-methylbenzenesulfonyl fluoride