diethyl vinylphosphonate


1-diethoxyphosphorylethene; diethyl vinylphosphonate; diethylvinylphosphonate; vinyldiethoxyoxophosphine
Links:🕷 ChemSpider
CAS:[682-30-4]
Formula:C6H13O3P; 164.14 g/mol
InChiKey:DREPONDJUKIQLX-UHFFFAOYSA-N
SMILES:CCO[P](=O)(OCC)C=C
Molecular structure of diethyl vinylphosphonate
Density:1.068 g/mL
Molar volume:153.7 mL/mol
Refractive index:1.429
Molecular refractive power:39.62 mL/mol
Dipole moment:2.91 D
Boiling point:202 °C

Isomers

2-butoxy-1,3,2-dioxaphospholane
Molecular structure of 2-butoxy-1,3,2-dioxaphospholane
2-tert-butoxy-1,3,2-dioxaphospholane
Molecular structure of 2-tert-butoxy-1,3,2-dioxaphospholane
diethyl vinylphosphonate
Molecular structure of diethyl vinylphosphonate
2-isobutoxy-1,3,2-dioxaphospholane
Molecular structure of 2-isobutoxy-1,3,2-dioxaphospholane
4,4,5,5-tetramethyl-1,3,2-dioxaphospholane 2-oxide
Molecular structure of 4,4,5,5-tetramethyl-1,3,2-dioxaphospholane 2-oxide