diethyl isophthalate


diethyl 1,3-benzenedicarboxylate; diethyl benzene-1,3-dicarboxylate; diethyl isophthalate; ethyl isophthalate; ethyl m-phthalate; isophthalic acid diethyl ester
Links:📏 NIST
CAS:[636-53-3]
Formula:C12H14O4; 222.24 g/mol
InChiKey:JLVWYWVLMFVCDI-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cccc(c1)C(=O)OCC
Molecular structure of diethyl isophthalate
Density:1.121 g/mL
Molar volume:198.3 mL/mol
Refractive index:1.507
Molecular refractive power:59.00 mL/mol
Dipole moment:2.41 D
Melting point:11 °C
Boiling point:285 °C

Isomers

benzyl ethyl malonate
Molecular structure of benzyl ethyl malonate
(R)-(+)-2-benzylsuccinic acid 1-methyl ester
Molecular structure of (R)-(+)-2-benzylsuccinic acid 1-methyl ester
1,4-bis(glycidyloxy)benzene
Molecular structure of 1,4-bis(glycidyloxy)benzene
2-butoxycarbonylbenzoic acid
Molecular structure of 2-butoxycarbonylbenzoic acid
5-tert-butylbenzene-1,3-dicarboxylic acid
Molecular structure of 5-tert-butylbenzene-1,3-dicarboxylic acid
tert-butyl 4-formylphenyl carbonate
Molecular structure of tert-butyl 4-formylphenyl carbonate
diethyl isophthalate
Molecular structure of diethyl isophthalate
diethyl phthalate
Molecular structure of diethyl phthalate
diethyl terephthalate
Molecular structure of diethyl terephthalate
dillapiole
Molecular structure of dillapiole
dimecrotic acid
Molecular structure of dimecrotic acid
4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole
Molecular structure of 4,7-dimethoxy-5-[(E)-prop-1-enyl]-1,3-benzodioxole
4,7-dimethoxy-5-prop-2-enyl-1,3-benzodioxole
Molecular structure of 4,7-dimethoxy-5-prop-2-enyl-1,3-benzodioxole
2-(2,2-dimethylpropanoyloxy)benzoic acid
Molecular structure of 2-(2,2-dimethylpropanoyloxy)benzoic acid
1,4-dipropionyloxybenzene
Molecular structure of 1,4-dipropionyloxybenzene
ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Molecular structure of ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
ethyl (2-methoxybenzoyl)acetate
Molecular structure of ethyl (2-methoxybenzoyl)acetate
ethyl (3-methoxybenzoyl)acetate
Molecular structure of ethyl (3-methoxybenzoyl)acetate
4-formyl-2-methoxyphenyl 2-methylpropanoate
Molecular structure of 4-formyl-2-methoxyphenyl 2-methylpropanoate
2-hydroxy-3-phenoxypropyl acrylate
Molecular structure of 2-hydroxy-3-phenoxypropyl acrylate
(E)-[2-methoxy-4-(1-propenyl)phenoxy]acetic acid
Molecular structure of (E)-[2-methoxy-4-(1-propenyl)phenoxy]acetic acid
[2-methoxy-4-(2-propenyl)phenoxy]acetic acid
Molecular structure of [2-methoxy-4-(2-propenyl)phenoxy]acetic acid
methyl 2-hydroxy-3-methoxy-5-prop-2-enylbenzoate
Molecular structure of methyl 2-hydroxy-3-methoxy-5-prop-2-enylbenzoate
oxolan-2-ylmethyl 2-hydroxybenzoate
Molecular structure of oxolan-2-ylmethyl 2-hydroxybenzoate
1,4-phenylenedipropionic acid
Molecular structure of 1,4-phenylenedipropionic acid
piperonyl isobutyrate
Molecular structure of piperonyl isobutyrate
resorcinol diglycidyl ether
Molecular structure of resorcinol diglycidyl ether