diethyl decanedioate


decanedioic acid diethyl ester; diethyl decanedioate; diethyl sebacate; diethyl sebacinate; ethyl sebacate; sebacic acid diethyl ester; sebacic acid ethyl ester
Links:📏 NIST, 📖 PubMed
CAS:[110-40-7]
Formula:C14H26O4; 258.36 g/mol
InChiKey:ONKUXPIBXRRIDU-UHFFFAOYSA-N
SMILES:CCOC(=O)CCCCCCCCC(=O)OCC
Molecular structure of diethyl decanedioate
Density:0.964 g/mL
Molar volume:268.0 mL/mol
Refractive index:1.437
Molecular refractive power:70.21 mL/mol
Dielectric constant:5.00
Dipole moment:2.49 D
Melting point:2 °C
Boiling point:307 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Surface tension:33.17 dyn/cm

Isomers

bis(2-methylbutyl) butanedioate
Molecular structure of bis(2-methylbutyl) butanedioate
bis(3-methylbutyl) butanedioate
Molecular structure of bis(3-methylbutyl) butanedioate
bis(2-methylpropyl) hexanedioate
Molecular structure of bis(2-methylpropyl) hexanedioate
dibutyl hexanedioate
Molecular structure of dibutyl hexanedioate
dibutyl 2-propylpropanedioate
Molecular structure of dibutyl 2-propylpropanedioate
diethyl decanedioate
Molecular structure of diethyl decanedioate
diethyl 2-ethyl-2-(3-methylbutyl)propanedioate
Molecular structure of diethyl 2-ethyl-2-(3-methylbutyl)propanedioate
diethyl heptylmalonate
Molecular structure of diethyl heptylmalonate
dihexyl oxalate
Molecular structure of dihexyl oxalate
dimethyl dodecanedioate
Molecular structure of dimethyl dodecanedioate
dipentyl butanedioate
Molecular structure of dipentyl butanedioate
dipropyl octanedioate
Molecular structure of dipropyl octanedioate
dipropyl 2-pentylpropanedioate
Molecular structure of dipropyl 2-pentylpropanedioate
6-(1-ethyl-1-hydroxypropyl)-2,2,6-trimethyltetrahydro-2H-pyran-3-carboxylic acid
Molecular structure of 6-(1-ethyl-1-hydroxypropyl)-2,2,6-trimethyltetrahydro-2H-pyran-3-carboxylic acid
tetradecanedioic acid
Molecular structure of tetradecanedioic acid