diethyl cyclohexane-1,1-dicarboxylate


cyclohexane-1,1-dicarboxylic acid diethyl ester; diethyl cyclohexane-1,1-dicarboxylate
CAS:[1139-13-5]
Formula:C12H20O4; 228.29 g/mol
InChiKey:MLHUKQNAQSRVKI-UHFFFAOYSA-N
SMILES:CCOC(=O)C1(CCCCC1)C(=O)OCC
Molecular structure of diethyl cyclohexane-1,1-dicarboxylate
Dipole moment:2.23 D

Isomers

bis(2-methylpropyl) (2E)-2-butenedioate
Molecular structure of bis(2-methylpropyl) (2E)-2-butenedioate
bis(2-methylpropyl) (2Z)-2-butenedioate
Molecular structure of bis(2-methylpropyl) (2Z)-2-butenedioate
1,2,3,4,5α,6,7,8,9,10α-decahydrooxanthrene-4α,9α-diol
Molecular structure of 1,2,3,4,5a,6,7,8,9,10a-decahydrooxanthrene-4a,9a-diol
dibutyl (2E)-2-butenedioate
Molecular structure of dibutyl (2E)-2-butenedioate
dibutyl (2Z)-2-butenedioate
Molecular structure of dibutyl (2Z)-2-butenedioate
diethyl cyclohexane-1,1-dicarboxylate
Molecular structure of diethyl cyclohexane-1,1-dicarboxylate
diethyl cis-1,2-cyclohexanedicarboxylate
Molecular structure of diethyl cis-1,2-cyclohexanedicarboxylate
diethyl trans-1,2-cyclohexanedicarboxylate
Molecular structure of diethyl trans-1,2-cyclohexanedicarboxylate
diethyl cis-1,3-cyclohexanedicarboxylate
Molecular structure of diethyl cis-1,3-cyclohexanedicarboxylate
diethyl cis-1,4-cyclohexanedicarboxylate
Molecular structure of diethyl cis-1,4-cyclohexanedicarboxylate
diethyl (E)-2-ethyl-3-methyl-2-pentendioate
Molecular structure of diethyl (E)-2-ethyl-3-methyl-2-pentendioate
diethyl (Z)-2-ethyl-3-methyl-2-pentendioate
Molecular structure of diethyl (Z)-2-ethyl-3-methyl-2-pentendioate
diisobutyl fumarate
Molecular structure of diisobutyl fumarate
dimethyl camphorate
Molecular structure of dimethyl camphorate
dimethyl cyclohexane-1,1-diacetic acid
Molecular structure of dimethyl cyclohexane-1,1-diacetic acid
dimethyl 3-methylcyclopentane-1,1-diacetate
Molecular structure of dimethyl 3-methylcyclopentane-1,1-diacetate
dipropyl cyclobutane-1,1-dicarboxylate
Molecular structure of dipropyl cyclobutane-1,1-dicarboxylate
dipropyl 2-prop-2-enylpropanedioate
Molecular structure of dipropyl 2-prop-2-enylpropanedioate
2-[(E)-oct-2-enyl]butanedioic acid
Molecular structure of 2-[(E)-oct-2-enyl]butanedioic acid
traumatic acid
Molecular structure of traumatic acid