diethyl cyclobutane-1,1-dicarboxylate


cyclobutane-1,1-dicarboxylic acid ethyl ester; diethyl 1,1-cyclobutanedicarboxylate; diethyl cyclobutane-1,1-dicarboxylate; diethyl cyclobutane-1:1-dicarboxylate
Links:📏 NIST
CAS:[3779-29-1]
Formula:C10H16O4; 200.23 g/mol
InChiKey:JPNJEJSZSMXWSV-UHFFFAOYSA-N
SMILES:CCOC(=O)C1(CCC1)C(=O)OCC
Molecular structure of diethyl cyclobutane-1,1-dicarboxylate
Density:1.047 g/mL
Molar volume:191.3 mL/mol
Refractive index:1.436
Molecular refractive power:50.01 mL/mol
Dipole moment:2.22 D
Boiling point:224 °C
Surface tension:31.67 dyn/cm

Isomers

(-)-camphoric acid
Molecular structure of (-)-camphoric acid
camphoric acid
Molecular structure of camphoric acid
l-camphoric acid
Molecular structure of l-camphoric acid
cyclohexane-1,1-diacetic acid
Molecular structure of cyclohexane-1,1-diacetic acid
cis-cyclohexane-1,2-diacetic acid
Molecular structure of cis-cyclohexane-1,2-diacetic acid
trans-cyclohexane-1,2-diacetic acid
Molecular structure of trans-cyclohexane-1,2-diacetic acid
1,4-cyclohexanedione bisethylene ketal
Molecular structure of 1,4-cyclohexanedione bisethylene ketal
diethyl cyclobutane-1,1-dicarboxylate
Molecular structure of diethyl cyclobutane-1,1-dicarboxylate
diethyl isopropylidenepropanedioate
Molecular structure of diethyl isopropylidenepropanedioate
diethyl (E)-3-methyl-2-pentendioate
Molecular structure of diethyl (E)-3-methyl-2-pentendioate
diethyl (Z)-3-methyl-2-pentendioate
Molecular structure of diethyl (Z)-3-methyl-2-pentendioate
diethyl 2-prop-2-enylpropanedioate
Molecular structure of diethyl 2-prop-2-enylpropanedioate
diisopropyl fumarate
Molecular structure of diisopropyl fumarate
dimethyl cyclohexane-1,1-dicarboxylate
Molecular structure of dimethyl cyclohexane-1,1-dicarboxylate
dimethyl trans-cyclohexane-1,4-dicarboxylate
Molecular structure of dimethyl trans-cyclohexane-1,4-dicarboxylate
dipropyl (2E)-2-butenedioate
Molecular structure of dipropyl (2E)-2-butenedioate
dipropyl (2Z)-2-butenedioate
Molecular structure of dipropyl (2Z)-2-butenedioate
ethyl 4-acetyl-5-oxohexanoate
Molecular structure of ethyl 4-acetyl-5-oxohexanoate
ethyl 5,5-dimethyl-2,4-dioxohexanoate
Molecular structure of ethyl 5,5-dimethyl-2,4-dioxohexanoate
ethyl (R)-cis-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propenoate
Molecular structure of ethyl (R)-cis-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propenoate
ethyl (R)-(-)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-trans-2-propenoate
Molecular structure of ethyl (R)-(-)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-trans-2-propenoate
ethyl trans-(S)-(+)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoate
Molecular structure of ethyl trans-(S)-(+)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-propenoate
ethyl 6,6-dimethyl-2-oxooxane-3-carboxylate
Molecular structure of ethyl 6,6-dimethyl-2-oxooxane-3-carboxylate
(5-ethyl-1,3-dioxan-5-yl)methyl prop-2-enoate
Molecular structure of (5-ethyl-1,3-dioxan-5-yl)methyl prop-2-enoate
ethyl 2-ethoxymethylene-3-oxopentanoate
Molecular structure of ethyl 2-ethoxymethylene-3-oxopentanoate
3-methylcyclopentane-1,1-diacetic acid
Molecular structure of 3-methylcyclopentane-1,1-diacetic acid