diethyl allylphosphonate


allyldiethoxyoxophosphine; diethyl allylphosphonate
Links:🕷 ChemSpider
CAS:[1067-87-4]
Formula:C7H15O3P; 178.17 g/mol
InChiKey:YPJHXRAHMUKXAE-UHFFFAOYSA-N
SMILES:CCO[P](=O)(CC=C)OCC
Molecular structure of diethyl allylphosphonate
Density:1.036 g/mL
Molar volume:172.0 mL/mol
Refractive index:1.435
Molecular refractive power:44.88 mL/mol
Dipole moment:2.92 D

Isomers

diethyl allylphosphonate
Molecular structure of diethyl allylphosphonate
diethyl (1E)-1-propenylphosphonate
Molecular structure of diethyl (1E)-1-propenylphosphonate
2-pentoxy-1,3,2-dioxaphospholane
Molecular structure of 2-pentoxy-1,3,2-dioxaphospholane
2-propoxy-4-methyl-1,3,2-dioxaphosphorinane
Molecular structure of 2-propoxy-4-methyl-1,3,2-dioxaphosphorinane