diethyl 4,4'-azoxybenzoate


diethyl 4,4'-azoxybenzoate; diethyl p,p'-azoxybenzoate
Links:📏 NIST
CAS:[6421-04-1]
Formula:C18H18N2O5; 342.35 g/mol
InChiKey:LOOVRYZFUGHEMF-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccc([N-][N+](=O)c2ccc(cc2)C(=O)OCC)cc1
Molecular structure of diethyl 4,4'-azoxybenzoate
Dipole moment:3.20 D