diethyl 2-hydroxybutanedioate


diethyl hydroxybutanedioate; diethyl 2-hydroxybutanedioate; diethyl malate; ethyl malate; malic acid diethyl ester; malic acid ethyl ester
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS RN:[7554-12-3]
Formula:C8H14O5; 190.20 g/mol
InChiKey:VKNUORWMCINMRB-UHFFFAOYSA-N
SMILES:CCOC(=O)CC(O)C(=O)OCC
Molecular structure of diethyl 2-hydroxybutanedioate
Density:1.129 g/mL
Molar volume:168.5 mL/mol
Refractive index:1.436
Molecular refractive power:44.05 mL/mol
Dielectric constant:10.20
Boiling point:253 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature

Isomers

diethylene glycol diacetate
Molecular structure of diethylene glycol diacetate
diethyl 2-hydroxybutanedioate
Molecular structure of diethyl 2-hydroxybutanedioate
1,2-O-isopropylidene-α-D-xylofuranose
Molecular structure of 1,2-O-isopropylidene-a-D-xylofuranose
methyl 4,4-dimethoxy-3-oxopentanoate
Molecular structure of methyl 4,4-dimethoxy-3-oxopentanoate
methyl 3,4-O-isopropylidene-L-threonate
Molecular structure of methyl 3,4-O-isopropylidene-L-threonate
methyl 2-[(propoxycarbonyl)oxy]propanoic acid
Molecular structure of methyl 2-[(propoxycarbonyl)oxy]propanoic acid