diethyl 2-butynedioate


diethyl acetylenedicarboxylate; diethyl 2-butynedioate; diethyl but-2-ynedioate
Links:📖 PubMed
CAS:[762-21-0]
Formula:C8H10O4; 170.17 g/mol
InChiKey:STRNXFOUBFLVIN-UHFFFAOYSA-N
SMILES:CCOC(=O)C#CC(=O)OCC
Molecular structure of diethyl 2-butynedioate
Density:1.068 g/mL
Molar volume:159.4 mL/mol
Refractive index:1.442
Molecular refractive power:42.21 mL/mol
Dipole moment:2.62 D
Melting point:2 °C
Surface tension:33.22 dyn/cm

Isomers

4-acetoxy-2,5-dimethyl-3(2~H)furanone
Molecular structure of 4-acetoxy-2,5-dimethyl-3(2H)furanone
but-2-yn-1,4-diyl diacetate
Molecular structure of but-2-yn-1,4-diyl diacetate
1-cyclohexene-1,4-dicarboxylic acid
Molecular structure of 1-cyclohexene-1,4-dicarboxylic acid
cis-4-cyclohexene-1,2-dicarboxylic acid
Molecular structure of cis-4-cyclohexene-1,2-dicarboxylic acid
trans-4-cyclohexene-1,2-dicarboxylic acid
Molecular structure of trans-4-cyclohexene-1,2-dicarboxylic acid
diallyl oxalate
Molecular structure of diallyl oxalate
3,4-diethoxy-3-cyclobutene-1,2-dione
Molecular structure of 3,4-diethoxy-3-cyclobutene-1,2-dione
diethyl 2-butynedioate
Molecular structure of diethyl 2-butynedioate
3,4-dihydro-2,2-dimethyl-4-oxo-2H-pyran-6-carboxylic acid
Molecular structure of 3,4-dihydro-2,2-dimethyl-4-oxo-2H-pyran-6-carboxylic acid
1,4-dihydroxy-2,6-dimethoxybenzene
Molecular structure of 1,4-dihydroxy-2,6-dimethoxybenzene
6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione
Molecular structure of 6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione
2,5-dimethyl-2,4-hexadienedioic acid
Molecular structure of 2,5-dimethyl-2,4-hexadienedioic acid
ethylene glycol diacrylate
Molecular structure of ethylene glycol diacrylate
[2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol
Molecular structure of [2-(furan-2-yl)-1,3-dioxolan-4-yl]methanol
(2E)-3-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid
Molecular structure of (2E)-3-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid
octane-2,4,5,7-tetrone
Molecular structure of octane-2,4,5,7-tetrone
trans,trans-1,4-diacetoxy-1,3-butadiene
Molecular structure of trans,trans-1,4-diacetoxy-1,3-butadiene