diethyl (R,S)-tartarate


diethyl (2R,3S)-2,3-dihydroxybutanedioate; diethyl mesotartrate; diethyl (R,S)-tartarate; diethyl meso-tartrate; diethyl tartrate
Links:🌍 Wikipedia, 📖 PubMed
CAS:[87-91-2]
Formula:C8H14O6; 206.20 g/mol
InChiKey:YSAVZVORKRDODB-OLQVQODUSA-N
SMILES:CCOC(=O)[C@@H](O)[C@@H](O)C(=O)OCC
Molecular structure of diethyl (R,S)-tartarate
Dielectric constant:4.50
Dipole moment:3.66 D
Melting point:17 °C
Boiling point:280 °C
Log10 partition octanol / water:-0.29

Isomers

diethyl (2R,3R)-2,3-dihydroxybutanedioate
Molecular structure of diethyl (2R,3R)-2,3-dihydroxybutanedioate
diethyl (2S,3S)-2,3-dihydroxybutanedioate
Molecular structure of diethyl (2S,3S)-2,3-dihydroxybutanedioate
diethyl (R,S)-tartarate
Molecular structure of diethyl (R,S)-tartarate
diethyl DL-tartrate
Molecular structure of diethyl DL-tartrate
diethyl (R*,R*)-tartrate
Molecular structure of diethyl (R*,R*)-tartrate
diisopropyl peroxydicarbonate
Molecular structure of diisopropyl peroxydicarbonate
dimethyl (R*,R*)-2,3-dimethoxysuccinate
Molecular structure of dimethyl (R*,R*)-2,3-dimethoxysuccinate
dimethyl (R,S)-2,3-dimethoxysuccinate
Molecular structure of dimethyl (R,S)-2,3-dimethoxysuccinate
4,6-O-ethylidene-α-D-glucose
Molecular structure of 4,6-O-ethylidene-a-D-glucose