dicyclohexylamine


N-cyclohexylcyclohexanamine; dicyclohexylamine
Links:📏 NIST, 📖 PubMed
MeSH:Enzyme Inhibitors
CAS:[101-83-7]
Formula:C12H23N; 181.32 g/mol
InChiKey:XBPCUCUWBYBCDP-UHFFFAOYSA-N
SMILES:C1CCC(CC1)NC2CCCCC2
Molecular structure of dicyclohexylamine
Density:0.912 g/mL
Molar volume:198.8 mL/mol
Refractive index:1.485
Molecular refractive power:56.92 mL/mol
Dipole moment:1.10 D
Melting point:-2 °C
Boiling point:256 °C
Surface tension:33.76 dyn/cm
Critical pressure:2.5 atm
Log10 partition octanol / water:4.37

Isomers

dicyclohexylamine
Molecular structure of dicyclohexylamine
dodecanenitrile
Molecular structure of dodecanenitrile