dicyclohexyl hexanedioate


dicyclohexyl adipate; dicyclohexyl hexanedioate
Links:📏 NIST
CAS:[849-99-0]
Formula:C18H30O4; 310.43 g/mol
InChiKey:UTGUHFOMNVLJSL-UHFFFAOYSA-N
SMILES:O=C(CCCCC(=O)OC1CCCCC1)OC2CCCCC2
Molecular structure of dicyclohexyl hexanedioate
Dielectric constant:4.84
Dipole moment:2.61 D

Isomers

but-2-yn-1,4-diyl diheptanoate
Molecular structure of but-2-yn-1,4-diyl diheptanoate
1,10-decamethylene glycol dimethacrylate
Molecular structure of 1,10-decamethylene glycol dimethacrylate
dicyclohexyl hexanedioate
Molecular structure of dicyclohexyl hexanedioate