dicyclohexyl (Z)-but-2-enedioate


dicyclohexyl (Z)-but-2-enedioate; dicyclohexyl maleate
Links:📏 NIST, 🕷 ChemSpider
CAS:[621-13-6]
Formula:C16H24O4; 280.36 g/mol
InChiKey:BLKQQTCUGZJWLN-QXMHVHEDSA-N
SMILES:O=C(OC1CCCCC1)C=C/C(=O)OC2CCCCC2
Molecular structure of dicyclohexyl (Z)-but-2-enedioate
Dipole moment:2.63 D

Isomers

brefeldin A
Molecular structure of brefeldin A
dicyclohexyl (Z)-but-2-enedioate
Molecular structure of dicyclohexyl (Z)-but-2-enedioate