dichlorodiphenylmethane


α,a-dichlorodiphenylmethane; dichlorodiphenylmethane; diphenyldichloromethane
CAS:[2051-90-3]
Formula:C13H10Cl2; 237.13 g/mol
InChiKey:OPTDDWCXQQYKGU-UHFFFAOYSA-N
SMILES:ClC(Cl)(c1ccccc1)c2ccccc2
Molecular structure of dichlorodiphenylmethane
Density:1.250 g/mL
Molar volume:189.7 mL/mol
Refractive index:1.605
Molecular refractive power:65.34 mL/mol
Dipole moment:2.28 D
Boiling point:305 °C

Isomers

1-chloro-4-(chloro-phenylmethyl)benzene
Molecular structure of 1-chloro-4-(chloro-phenylmethyl)benzene
dichlorodiphenylmethane
Molecular structure of dichlorodiphenylmethane
1,1'-methylenebis(4-chlorobenzene)
Molecular structure of 1,1'-methylenebis(4-chlorobenzene)