dichloro(4-methylphenyl)borane


dichloro(4-methylphenyl)borane; dichloro-p-tolylborane; dichloro-p-tolylborine
CAS:[4250-45-7]
Formula:C7H7BCl2; 172.85 g/mol
InChiKey:HVYKBZIMZNCXJR-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)B(Cl)Cl
Molecular structure of dichloro(4-methylphenyl)borane
Dipole moment:4.63 D