dichloro(1-chloroethyl)methylsilane


dichloro(1-chloroethyl)methylsilane
CAS:[7787-84-0]
Formula:C3H7Cl3Si; 177.53 g/mol
InChiKey:DOMFCJHYKYJCCA-UHFFFAOYSA-N
SMILES:CC(Cl)[Si](C)(Cl)Cl
Molecular structure of dichloro(1-chloroethyl)methylsilane
Dipole moment:1.87 D

Isomers

chloro(dichloromethyl)dimethylsilane
Molecular structure of chloro(dichloromethyl)dimethylsilane
dichloro(1-chloroethyl)methylsilane
Molecular structure of dichloro(1-chloroethyl)methylsilane
dichloro(2-chloroethyl)methylsilane
Molecular structure of dichloro(2-chloroethyl)methylsilane
trichloro(1-methylethyl)silane
Molecular structure of trichloro(1-methylethyl)silane