dibutyl-dichlorostannane


dibutyl-dichlorostannane; dibutyldichlorotin; dibutylstannic chloride; dibutyltin chloride; di-n-butyltin dichloride; dibutyltin dichloride
Links:🕷 ChemSpider, 📖 PubMed
MeSH:Immunologic Factors; Noxae; Immunologic Factors; Noxae
CAS:[683-18-1]
Formula:C8H18Cl2Sn; 303.85 g/mol
InChiKey:RJGHQTVXGKYATR-UHFFFAOYSA-L
SMILES:CCCC[Sn](Cl)(Cl)CCCC
Molecular structure of dibutyl-dichlorostannane
Density:1.360 g/mL
Molar volume:223.4 mL/mol
Refractive index:1.499
Molecular refractive power:65.61 mL/mol
Dipole moment:4.38 D
Melting point:39 °C
Log10 partition octanol / water:1.56