dibutyl terephthalate


1,4-dibutyl benzene-1,4-dicarboxylate; dibutyl terephthalate
Links:📏 NIST, 🕷 ChemSpider
CAS:[1962-75-0]
Formula:C16H22O4; 278.35 g/mol
InChiKey:LQLQDKBJAIILIQ-UHFFFAOYSA-N
SMILES:CCCCOC(=O)c1ccc(cc1)C(=O)OCCCC
Molecular structure of dibutyl terephthalate
Density:1.062 g/mL
Molar volume:262.2 mL/mol
Refractive index:1.497
Molecular refractive power:76.76 mL/mol
Dipole moment:2.53 D
Melting point:16 °C

Isomers

α,a,α',α'-tetramethyl-1,3-benzenedipropionic acid
Molecular structure of a,a,a',a'-tetramethyl-1,3-benzenedipropionic acid
bis(2-methylpropyl) benzene-1,2-dicarboxylate
Molecular structure of bis(2-methylpropyl) benzene-1,2-dicarboxylate
butyl isobutyl phthalate
Molecular structure of butyl isobutyl phthalate
dibutyl benzene-1,3-dicarboxylate
Molecular structure of dibutyl benzene-1,3-dicarboxylate
di(tert-butyl) phthalate
Molecular structure of di(tert-butyl) phthalate
dibutyl phthalate
Molecular structure of dibutyl phthalate
dibutyl terephthalate
Molecular structure of dibutyl terephthalate
ethyl 2-ethyl-2-(2-methoxybenzoyl)butanoate
Molecular structure of ethyl 2-ethyl-2-(2-methoxybenzoyl)butanoate
2-(2-ethylhexoxycarbonyl)benzoic acid
Molecular structure of 2-(2-ethylhexoxycarbonyl)benzoic acid