dibutyl sulfone


butyl sulfone; n-butyl sulfone; di-n-butyl sulfone; dibutyl sulfone; di-n-butyl sulphone; dibutyl sulphone; 1,1'-sulfonylbisbutane
Links:📏 NIST
CAS:[598-04-9]
Formula:C8H18O2S; 178.30 g/mol
InChiKey:AIDFJGKWTOULTC-UHFFFAOYSA-N
SMILES:CCCC[S](=O)(=O)CCCC
Molecular structure of dibutyl sulfone
Dielectric constant:25.72
Dipole moment:4.48 D
Melting point:44 °C
Boiling point:291 °C

Isomers

di-tert-butylsulfone
Molecular structure of di-tert-butylsulfone
dibutyl sulfone
Molecular structure of dibutyl sulfone