dibutyl benzene-1,3-dicarboxylate


dibutyl benzene-1,3-dicarboxylate; dibutyl isophthalate
Links:📏 NIST, 🕷 ChemSpider
CAS:[3126-90-7]
Formula:C16H22O4; 278.35 g/mol
InChiKey:GOPWOUQJIMLDDM-UHFFFAOYSA-N
SMILES:CCCCOC(=O)c1cccc(c1)C(=O)OCCCC
Molecular structure of dibutyl benzene-1,3-dicarboxylate
Density:1.066 g/mL
Molar volume:261.1 mL/mol
Refractive index:1.498
Molecular refractive power:76.55 mL/mol
Dipole moment:2.52 D

Isomers

α,a,α',α'-tetramethyl-1,3-benzenedipropionic acid
Molecular structure of a,a,a',a'-tetramethyl-1,3-benzenedipropionic acid
bis(2-methylpropyl) benzene-1,2-dicarboxylate
Molecular structure of bis(2-methylpropyl) benzene-1,2-dicarboxylate
butyl isobutyl phthalate
Molecular structure of butyl isobutyl phthalate
dibutyl benzene-1,3-dicarboxylate
Molecular structure of dibutyl benzene-1,3-dicarboxylate
di(tert-butyl) phthalate
Molecular structure of di(tert-butyl) phthalate
dibutyl phthalate
Molecular structure of dibutyl phthalate
dibutyl terephthalate
Molecular structure of dibutyl terephthalate
ethyl 2-ethyl-2-(2-methoxybenzoyl)butanoate
Molecular structure of ethyl 2-ethyl-2-(2-methoxybenzoyl)butanoate
2-(2-ethylhexoxycarbonyl)benzoic acid
Molecular structure of 2-(2-ethylhexoxycarbonyl)benzoic acid