dibutoxydimethylsilane


dibutoxy(dimethyl)silane; dibutoxydimethylsilane; dimethyldibutoxysilane; DMDB
Links:📖 PubMed
CAS:[1591-02-2]
Formula:C10H24O2Si; 204.38 g/mol
InChiKey:GQNWJCQWBFHQAO-UHFFFAOYSA-N
SMILES:CCCCO[Si](C)(C)OCCCC
Molecular structure of dibutoxydimethylsilane
Dielectric constant:2.84
Dipole moment:1.28 D

Isomers

bis(1-methylpropoxy)dimethylsilane
Molecular structure of bis(1-methylpropoxy)dimethylsilane
4-(tert-butyldimethylsilyl)oxy-1-butanol
Molecular structure of 4-(tert-butyldimethylsilyl)oxy-1-butanol
dibutoxydimethylsilane
Molecular structure of dibutoxydimethylsilane
diisobutyldimethoxysilane
Molecular structure of diisobutyldimethoxysilane
di(2-methylpropoxy)dimethylsilane
Molecular structure of di(2-methylpropoxy)dimethylsilane