dibenzyl sulfoxide


benzyl sulfoxide; dibenzyl sulfoxide; dibenzyl sulphoxide; (phenylmethanesulfinylmethyl)benzene; phenylmethylsulfinylmethylbenzene; 1,1'-sulfinylbis(methylene)bisbenzene
Links:🕷 ChemSpider, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[621-08-9]
Formula:C14H14OS; 230.33 g/mol
InChiKey:HTMQZWFSTJVJEQ-UHFFFAOYSA-N
SMILES:O=[S](Cc1ccccc1)Cc2ccccc2
Molecular structure of dibenzyl sulfoxide
Dipole moment:3.76 D
Melting point:133 °C

Isomers

bis(4-methylphenyl) sulfoxide
Molecular structure of bis(4-methylphenyl) sulfoxide
2-butylthio-1,4-naphthoquinone
Molecular structure of 2-butylthio-1,4-naphthoquinone
dibenzyl sulfoxide
Molecular structure of dibenzyl sulfoxide