dibenzyl sulfone


dibenzyl sulfone; phenylmethylsulfonylmethylbenzene
Links:📏 NIST
CAS:[620-32-6]
Formula:C14H14O2S; 246.33 g/mol
InChiKey:AWHNUHMUCGRKRA-UHFFFAOYSA-N
SMILES:O=[S](=O)(Cc1ccccc1)Cc2ccccc2
Molecular structure of dibenzyl sulfone
Dipole moment:4.25 D
Melting point:151 °C

Isomers

dibenzyl sulfone
Molecular structure of dibenzyl sulfone
1-methyl-2-[(phenylsulfonyl)methyl]benzene
Molecular structure of 1-methyl-2-[(phenylsulfonyl)methyl]benzene
1,1'-sulfonylbis(4-methylbenzene)
Molecular structure of 1,1'-sulfonylbis(4-methylbenzene)