dibenzyl sulfide


benzylsulfanylmethylbenzene; benzyl sulfide; dibenzyl sulfide; dibenzyl sulphide; phenylmethylsulfanylmethylbenzene
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Benzylsulfid); p. 66
CAS:[538-74-9]
Formula:C14H14S; 214.33 g/mol
InChiKey:LUFPJJNWMYZRQE-UHFFFAOYSA-N
SMILES:C(SCc1ccccc1)c2ccccc2
Molecular structure of dibenzyl sulfide
Dipole moment:1.34 D
Melting point:49 °C

Isomers

bis(4-methylphenyl) sulfide
Molecular structure of bis(4-methylphenyl) sulfide
dibenzyl sulfide
Molecular structure of dibenzyl sulfide
4,5,6,7-tetrahydro-2-phenylcyclopenta[β]thiopyran
Molecular structure of 4,5,6,7-tetrahydro-2-phenylcyclopenta[b]thiopyran