dibenzyl disulfide


benzyldisulfanylmethylbenzene; benzyl disulfide; bis(phenylmethyl) disulfide; dibenzyl disulfide
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Benzyldisulfid); p. 1032
CAS:[150-60-7]
Formula:C14H14S2; 246.40 g/mol
InChiKey:GVPWHKZIJBODOX-UHFFFAOYSA-N
SMILES:C(SSCc1ccccc1)c2ccccc2
Molecular structure of dibenzyl disulfide
Density:1.300 g/mL
Molar volume:189.5 mL/mol
Dipole moment:1.87 D
Melting point:70 °C

Isomers

4,4'-bis(mercaptomethyl)biphenyl
Molecular structure of 4,4'-bis(mercaptomethyl)biphenyl
bis(4-methylphenyl) disulfide
Molecular structure of bis(4-methylphenyl) disulfide
1,2-bis(phenylthio)ethane
Molecular structure of 1,2-bis(phenylthio)ethane
dibenzyl disulfide
Molecular structure of dibenzyl disulfide