dibenzothiophene 5,5-dioxide


dibenzothiophene 5,5-dioxide; dibenzothiophene S,S-dioxide; dibenzothiophene sulfone
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[1016-05-3]
Formula:C12H8O2S; 216.26 g/mol
InChiKey:IKJFYINYNJYDTA-UHFFFAOYSA-N
SMILES:O=[S]1(=O)c2ccccc2c3ccccc13
Molecular structure of dibenzothiophene 5,5-dioxide
Dipole moment:5.03 D
Melting point:232 °C

Isomers

dibenzothiophene 5,5-dioxide
Molecular structure of dibenzothiophene 5,5-dioxide
phenoxathiine 10-oxide
Molecular structure of phenoxathiine 10-oxide