diazoacetophenone


diazoacetophenone
Links:📖 PubMed
Formula:C8H6N2O; 146.15 g/mol
InChiKey:ZSTBZBURMWJKSQ-UHFFFAOYSA-N
SMILES:[N-]=[N+]=CC(=O)c1ccccc1
Molecular structure of diazoacetophenone
Dipole moment:3.66 D

Isomers

7-azaindole-3-carboxaldehyde
Molecular structure of 7-azaindole-3-carboxaldehyde
8-cinnolinol
Molecular structure of 8-cinnolinol
1H-cinnolin-4-one
Molecular structure of 1H-cinnolin-4-one
3-cinnolone
Molecular structure of 3-cinnolone
2-cyanobenzamide
Molecular structure of 2-cyanobenzamide
3-cyanobenzamide
Molecular structure of 3-cyanobenzamide
4-cyanobenzamide
Molecular structure of 4-cyanobenzamide
N-(4-cyanophenyl)formamide
Molecular structure of N-(4-cyanophenyl)formamide
diazoacetophenone
Molecular structure of diazoacetophenone
4-hydroxyquinazoline
Molecular structure of 4-hydroxyquinazoline
5-hydroxyquinazoline
Molecular structure of 5-hydroxyquinazoline
imidazo[1,2-α]pyridine-5-carboxaldehyde
Molecular structure of imidazo[1,2-a]pyridine-5-carboxaldehyde
imidazo[1,2-α]pyridine-6-carboxaldehyde
Molecular structure of imidazo[1,2-a]pyridine-6-carboxaldehyde
1H-indazole-3-carboxaldehyde
Molecular structure of 1H-indazole-3-carboxaldehyde
1H-indazole-6-carboxaldehyde
Molecular structure of 1H-indazole-6-carboxaldehyde
indazole-5-carboxaldehyde
Molecular structure of indazole-5-carboxaldehyde
1,6-naphthyridin-8-ol
Molecular structure of 1,6-naphthyridin-8-ol
1,7-naphthyridin-8(7~H)-one
Molecular structure of 1,7-naphthyridin-8(7H)-one
2H-phthalazin-1-one
Molecular structure of 2H-phthalazin-1-one
pyrazolo[1,5-α]pyridine-7-carboxaldehyde
Molecular structure of pyrazolo[1,5-a]pyridine-7-carboxaldehyde
quinazoline-3-oxide
Molecular structure of quinazoline-3-oxide
8-quinazolinol
Molecular structure of 8-quinazolinol
1H-quinazolin-2-one
Molecular structure of 1H-quinazolin-2-one
quinazolin-4(3~H)-one
Molecular structure of quinazolin-4(3H)-one
quinoxaline N-oxide
Molecular structure of quinoxaline N-oxide
2-quinoxalinol
Molecular structure of 2-quinoxalinol
5-quinoxalinol
Molecular structure of 5-quinoxalinol