diacetoxydibutylstannane


diacetoxydibutylstannane; diacetoxydibutyltin; di-n-butyltin diacetate; dibutyltin diacetate
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
CAS:[1067-33-0]
Formula:C12H24O4Sn; 351.03 g/mol
InChiKey:JJLKTTCRRLHVGL-UHFFFAOYSA-L
SMILES:CCCC[Sn](CCCC)(OC(C)=O)OC(C)=O
Molecular structure of diacetoxydibutylstannane
Density:1.300 g/mL
Molar volume:270.0 mL/mol
Refractive index:1.470
Molecular refractive power:75.34 mL/mol
Dipole moment:1.39 D
Melting point:12 °C