di-tert-butyl disulfide


bis(1,1-dimethylethyl) disulfide; tert-butyl disulfide; tert-butyl disulphide; di-tert-butyl disulfide; di-tert-butyl disulphide; di-t-butyl disulfide
Links:📏 NIST, 📖 PubMed
CAS:[110-06-5]
Formula:C8H18S2; 178.36 g/mol
InChiKey:BKCNDTDWDGQHSD-UHFFFAOYSA-N
SMILES:CC(C)(C)SSC(C)(C)C
Molecular structure of di-tert-butyl disulfide
Density:0.923 g/mL
Molar volume:193.3 mL/mol
Refractive index:1.490
Molecular refractive power:55.88 mL/mol
Dipole moment:1.89 D
Melting point:-5 °C
Boiling point:200 °C
Surface tension:27.33 dyn/cm

Isomers

di-tert-butyl disulfide
Molecular structure of di-tert-butyl disulfide
dibutyl disulfide
Molecular structure of dibutyl disulfide
diisobutyl disulfide
Molecular structure of diisobutyl disulfide
1,8-octanedithiol
Molecular structure of 1,8-octanedithiol