di(pyridin-3-yl)diazene


3-azopyridine; trans-3,3'-azopyridine; di(pyridin-3-yl)diazene
Links:📖 PubMed
Formula:C10H8N4; 184.20 g/mol
InChiKey:YKROEKFLSMDUSV-UHFFFAOYSA-N
SMILES:c1cncc(c1)N=Nc2cccnc2
Molecular structure of di(pyridin-3-yl)diazene
Dipole moment:2.42 D

Isomers

2-aminodipyrido[1,2-α:3',2'-δ]imidazole
Molecular structure of 2-aminodipyrido[1,2-a:3',2'-d]imidazole
5-amino-1-phenylpyrazole-4-carbonitrile
Molecular structure of 5-amino-1-phenylpyrazole-4-carbonitrile
N,N'-(2,5-dimethyl-2,5-cyclohexadiene-1,4-diylidene)biscyanamide
Molecular structure of N,N'-(2,5-dimethyl-2,5-cyclohexadiene-1,4-diylidene)biscyanamide
(E)-di(pyridin-2-yl)diazene
Molecular structure of (E)-di(pyridin-2-yl)diazene
di(pyridin-3-yl)diazene
Molecular structure of di(pyridin-3-yl)diazene
di(pyridin-4-yl)diazene
Molecular structure of di(pyridin-4-yl)diazene
[(4-methylphenyl)hydrazono]propanedinitrile
Molecular structure of [(4-methylphenyl)hydrazono]propanedinitrile