di(4-nitrophenyl) disulfide


bis(p-nitrophenyl) disulfide; bis(4-nitrophenyl) disulfide; p,p'-dinitrodiphenyl disulfide; di(4-nitrophenyl) disulfide; 1-nitro-4-(4-nitrophenyl)disulfanylbenzene; p-nitrophenyl disulfide; 4-nitrophenyl disulfide
Links:📏 NIST, 📖 PubMed
CAS:[100-32-3]
Formula:C12H8N2O4S2; 308.34 g/mol
InChiKey:KWGZRLZJBLEVFZ-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1ccc(SSc2ccc(cc2)[N+]([O-])=O)cc1
Molecular structure of di(4-nitrophenyl) disulfide
Dipole moment:3.63 D
Melting point:182 °C

Isomers

bis(3-nitrophenyl) disulfide
Molecular structure of bis(3-nitrophenyl) disulfide
di(2-nitrophenyl) disulfide
Molecular structure of di(2-nitrophenyl) disulfide
di(4-nitrophenyl) disulfide
Molecular structure of di(4-nitrophenyl) disulfide