di(2-nitrophenyl) disulfide


bis(2-nitrophenyl) disulfide; bis(2-nitrophenyl) disulfide; di(2-nitrophenyl) disulfide
Links:📏 NIST
CAS:[1155-00-6]
Formula:C12H8N2O4S2; 308.34 g/mol
InChiKey:NXCKJENHTITELM-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1ccccc1SSc2ccccc2[N+]([O-])=O
Molecular structure of di(2-nitrophenyl) disulfide
Dipole moment:5.37 D
Melting point:194 °C
Log10 partition octanol / water:3.37

Isomers

bis(3-nitrophenyl) disulfide
Molecular structure of bis(3-nitrophenyl) disulfide
di(2-nitrophenyl) disulfide
Molecular structure of di(2-nitrophenyl) disulfide
di(4-nitrophenyl) disulfide
Molecular structure of di(4-nitrophenyl) disulfide