N-(4-chlorophenyl)acetamide


p-chloroacetanilide; 4-chloroacetanilide; 4'-chloroacetanilide; N-(4-chlorophenyl)acetamide
Links:📏 NIST, ⚗️ ChemSynthesis
CAS:[539-03-7]
Formula:C8H8ClNO; 169.61 g/mol
InChiKey:GGUOCFNAWIODMF-UHFFFAOYSA-N
SMILES:CC(=O)Nc1ccc(Cl)cc1
Molecular structure of N-(4-chlorophenyl)acetamide
Density:1.385 g/mL
Molar volume:122.5 mL/mol
Melting point:179 °C
Boiling point:333 °C
Log10 partition octanol / water:2.12
1g dissolves in:
22.90g ethanol

Isomers

2-chloroacetanilide
Molecular structure of 2-chloroacetanilide
3-chloroacetanilide
Molecular structure of 3-chloroacetanilide
4'-chloroacetophenone oxime
Molecular structure of 4'-chloroacetophenone oxime
2-chloro-6-methylbenzamide
Molecular structure of 2-chloro-6-methylbenzamide
N-(2-chlorophenyl)acetamide
Molecular structure of N-(2-chlorophenyl)acetamide
N-(3-chlorophenyl)acetamide
Molecular structure of N-(3-chlorophenyl)acetamide
N-(4-chlorophenyl)acetamide
Molecular structure of N-(4-chlorophenyl)acetamide
N-methyl-N-phenylcarbamoyl chloride
Molecular structure of N-methyl-N-phenylcarbamoyl chloride