N-(4-bromo-2-chlorophenyl)acetamide


4-bromo-2-chloroacetanilide; 4'-bromo-2'-chloroacetanilide; N-(4-bromo-2-chlorophenyl)acetamide
Links:🕷 ChemSpider
CAS:[3460-23-9]
Formula:C8H7BrClNO; 248.51 g/mol
InChiKey:MITWNEIUIPGZKR-UHFFFAOYSA-N
SMILES:CC(=O)Nc1ccc(Br)cc1Cl
Molecular structure of N-(4-bromo-2-chlorophenyl)acetamide
Melting point:152 °C
1g dissolves in:
28.85g ethanol

Isomers

N-(2-bromo-4-chlorophenyl)acetamide
Molecular structure of N-(2-bromo-4-chlorophenyl)acetamide
N-(4-bromo-2-chlorophenyl)acetamide
Molecular structure of N-(4-bromo-2-chlorophenyl)acetamide
N-(4-bromo-3-chlorophenyl)acetamide
Molecular structure of N-(4-bromo-3-chlorophenyl)acetamide