N-(2,4-dibromophenyl)acetamide


2,4-dibromoacetanilide; 2',4'-dibromoacetanilide; N-(2,4-dibromophenyl)acetamide
Links:🕷 ChemSpider
CAS:[23373-04-8]
Formula:C8H7Br2NO; 292.96 g/mol
InChiKey:AIDNLFKPDZOXHF-UHFFFAOYSA-N
SMILES:CC(=O)Nc1ccc(Br)cc1Br
Molecular structure of N-(2,4-dibromophenyl)acetamide
1g dissolves in:
25.00g ethanol

Isomers

N-(2,4-dibromophenyl)acetamide
Molecular structure of N-(2,4-dibromophenyl)acetamide
N-(2,6-dibromophenyl)acetamide
Molecular structure of N-(2,6-dibromophenyl)acetamide